CymitQuimica logo

CAS 1260667-90-0

:

4-Bromo-6-fluoro-2-pyridinecarboxylic acid

Description:
4-Bromo-6-fluoro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 2-position of the pyridine ring, contributing to its acidic properties. The presence of bromine and fluorine substituents at the 4 and 6 positions, respectively, introduces significant electronegative elements that can influence the compound's reactivity and polarity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the halogen substituents may enhance its potential for various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the unique combination of halogen atoms and the carboxylic acid group may impart interesting biological activity, making it a candidate for further research in medicinal chemistry or agrochemicals. Overall, 4-Bromo-6-fluoro-2-pyridinecarboxylic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C6H3BrFNO2
InChI:InChI=1S/C6H3BrFNO2/c7-3-1-4(6(10)11)9-5(8)2-3/h1-2H,(H,10,11)
InChI key:InChIKey=GBKIPBMFLYLUGD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Br)=CC(F)=N1
Synonyms:
  • 2-Pyridinecarboxylic acid, 4-bromo-6-fluoro-
  • 4-Bromo-6-fluoro-2-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.