
CAS 1260669-24-6
:4-[(3,4-Dihydroxyphenyl)methyl]-3-(4-hydroxyphenyl)-2(5H)-furanone
Description:
4-[(3,4-Dihydroxyphenyl)methyl]-3-(4-hydroxyphenyl)-2(5H)-furanone, identified by its CAS number 1260669-24-6, is a synthetic organic compound characterized by its complex structure featuring a furanone ring and multiple hydroxyl groups. This compound exhibits properties typical of phenolic compounds, including potential antioxidant activity due to the presence of hydroxyl groups, which can donate hydrogen atoms and scavenge free radicals. The furanone moiety contributes to its reactivity and may influence its biological activity. The compound's solubility is likely influenced by its polar hydroxyl groups, making it more soluble in polar solvents. Additionally, the presence of multiple aromatic rings suggests potential interactions with biological systems, which may lead to various pharmacological effects. Its structural features may also allow for hydrogen bonding, affecting its stability and reactivity. Overall, this compound's unique characteristics make it a subject of interest in medicinal chemistry and materials science, although specific applications and biological activities would require further investigation.
Formula:C17H14O5
InChI:InChI=1S/C17H14O5/c18-13-4-2-11(3-5-13)16-12(9-22-17(16)21)7-10-1-6-14(19)15(20)8-10/h1-6,8,18-20H,7,9H2
InChI key:InChIKey=BIFVRZJCZAIDEH-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)OC1)C2=CC=C(O)C=C2)C3=CC(O)=C(O)C=C3
Synonyms:- 2(5H)-Furanone, 4-[(3,4-dihydroxyphenyl)methyl]-3-(4-hydroxyphenyl)-
- 4-[(3,4-Dihydroxyphenyl)methyl]-3-(4-hydroxyphenyl)-2(5H)-furanone
- Eutypoid C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ferroptosis-IN-15
CAS:Ferroptosis-IN-15 (compound 12) serves as an effective inhibitor of ferroptosis, exhibiting EC50 values of 0.76 μM and 0.67 μM in A375 cells and 786-O cells, respectively. It acts as a potential iron chelator and radical-scavenging antioxidant.Formula:C17H14O5Color and Shape:SolidMolecular weight:298.29
