
CAS 1260669-94-0
:2-Bromo-6,7-dihydro-4H-pyrano[3,4-d]oxazole
Description:
2-Bromo-6,7-dihydro-4H-pyrano[3,4-d]oxazole is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyran and an oxazole ring. The presence of a bromine atom at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits moderate solubility in polar organic solvents, reflecting its polar functional groups. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the electrophilic nature of the bromine atom. Additionally, the dihydro configuration indicates that it may exist in a stable, non-aromatic form, which can influence its reactivity and stability under different conditions. Overall, 2-Bromo-6,7-dihydro-4H-pyrano[3,4-d]oxazole is a compound of interest for further research in synthetic and medicinal chemistry.
Formula:C6H6BrNO2
InChI:InChI=1S/C6H6BrNO2/c7-6-8-4-3-9-2-1-5(4)10-6/h1-3H2
InChI key:InChIKey=REHJPXYGRCDQCU-UHFFFAOYSA-N
SMILES:BrC1=NC2=C(O1)CCOC2
Synonyms:- 2-Bromo-6,7-dihydro-4H-pyrano[3,4-d]oxazole
- 4H-Pyrano[3,4-d]oxazole, 2-bromo-6,7-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.