
CAS 1260670-12-9
:4-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine
Description:
4-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. The presence of a bromine atom at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a saturated ring system, indicated by the "tetrahydro" descriptor, which enhances its stability and solubility in various solvents. It is typically synthesized through multi-step organic reactions involving bromination and cyclization processes. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many brominated compounds, it may also present environmental and safety considerations, necessitating careful handling and disposal. Overall, 4-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine represents a valuable structure in the field of organic and medicinal chemistry.
Formula:C8H9BrN2
InChI:InChI=1S/C8H9BrN2/c9-7-1-4-11-8-2-3-10-5-6(7)8/h1,4,10H,2-3,5H2
InChI key:InChIKey=GRXWPDYHZGKUHH-UHFFFAOYSA-N
SMILES:BrC1=C2C(=NC=C1)CCNC2
Synonyms:- 4-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine
- 1,6-Naphthyridine, 4-bromo-5,6,7,8-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.