CymitQuimica logo

CAS 1260670-13-0

:

4-Chloro-5,6,7,8-tetrahydro-2-methylpyrido[2,3-d]pyrimidine

Description:
4-Chloro-5,6,7,8-tetrahydro-2-methylpyrido[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a methyl group at the 2-position enhances its reactivity and solubility in various solvents. This compound typically exhibits a solid state at room temperature and may have moderate to high polarity due to the electronegative chlorine atom. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound's synthesis may involve multi-step reactions, often requiring specific reagents and conditions to achieve the desired heterocyclic framework. Additionally, its stability and reactivity can be influenced by the presence of functional groups and the overall electronic environment of the molecule. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic organic chemistry.
Formula:C8H10ClN3
InChI:InChI=1S/C8H10ClN3/c1-5-11-7(9)6-3-2-4-10-8(6)12-5/h2-4H2,1H3,(H,10,11,12)
InChI key:InChIKey=GMRNTDXJEWLUCE-UHFFFAOYSA-N
SMILES:ClC1=C2C(NC(C)=N1)=NCCC2
Synonyms:
  • Pyrido[2,3-d]pyrimidine, 4-chloro-5,6,7,8-tetrahydro-2-methyl-
  • 4-Chloro-5,6,7,8-tetrahydro-2-methylpyrido[2,3-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.