CymitQuimica logo

CAS 1260670-15-2

:

3-(1-Aminocyclobutyl)benzonitrile

Description:
3-(1-Aminocyclobutyl)benzonitrile is a chemical compound characterized by its unique structure, which includes a benzonitrile moiety and a cyclobutyl group with an amino substituent. This compound features a benzene ring attached to a nitrile group (–C≡N) and a cyclobutyl ring that is further substituted with an amino group (–NH2). The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and organic synthesis. The compound's molecular structure contributes to its physical properties, such as solubility and melting point, which can vary based on the specific interactions of its functional groups. Additionally, the compound may exhibit biological activity, potentially influencing its application in pharmaceuticals or as a research tool in various chemical studies. Its CAS number, 1260670-15-2, allows for precise identification and retrieval of information regarding its safety, handling, and regulatory status in chemical databases.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c12-8-9-3-1-4-10(7-9)11(13)5-2-6-11/h1,3-4,7H,2,5-6,13H2
InChI key:InChIKey=WCFJXBIEYYVHNA-UHFFFAOYSA-N
SMILES:NC1(C2=CC(C#N)=CC=C2)CCC1
Synonyms:
  • 3-(1-Aminocyclobutyl)benzonitrile
  • Benzonitrile, 3-(1-aminocyclobutyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.