CAS 1260670-17-4

5-(Chloromethyl)-6-methyl-3-pyridinecarbonitrile

Description:

5-(Chloromethyl)-6-methyl-3-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group (-CH2Cl) and a cyano group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group enhances its lipophilicity, which can influence its solubility and interaction with biological systems. The chloromethyl group can serve as a reactive site for further chemical modifications, making it valuable in the synthesis of more complex molecules. Additionally, the cyano group is known for its ability to participate in nucleophilic reactions, further expanding its utility in various chemical processes. Overall, this compound's unique functional groups and structural features make it of interest in medicinal chemistry and material science, where it may be explored for its potential biological activities or as a building block in the synthesis of pharmaceuticals.

Formula: C₈H₇ClN₂

InChI: InChI=1S/C8H7ClN2/c1-6-8(3-9)2-7(4-10)5-11-6/h2,5H,3H2,1H3

InChI key: InChIKey=JDJSFVQUUFHZRM-UHFFFAOYSA-N

SMILES: C(Cl)C=1C=C(C#N)C=NC1C

Synonyms:

• 3-Pyridinecarbonitrile, 5-(chloromethyl)-6-methyl-
• 5-(Chloromethyl)-6-methyl-3-pyridinecarbonitrile