
CAS 1260670-54-9
:cis-3-Fluorocyclobutanamine
Description:
Cis-3-Fluorocyclobutanamine is a chemical compound characterized by its unique cyclic structure and the presence of a fluorine atom. As a derivative of cyclobutane, it features a four-membered carbon ring with an amine functional group and a fluorine substituent at the 3-position. The "cis" designation indicates that the fluorine and the amine group are on the same side of the ring, which can influence the compound's stereochemistry and reactivity. This compound is of interest in medicinal chemistry and organic synthesis due to its potential biological activity and the role of fluorine in enhancing the pharmacological properties of organic molecules. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions between the functional groups and the cyclic structure. Additionally, the presence of the fluorine atom can affect the compound's polarity and lipophilicity, making it relevant for drug design and development. Safety and handling considerations are essential, as with any chemical substance, particularly those containing amines and halogens.
Formula:C4H8FN
InChI:InChI=1/C4H8FN/c5-3-1-4(6)2-3/h3-4H,1-2,6H2/t3-,4+
InChI key:InChIKey=APCSZMINSACNSQ-ZXZARUISNA-N
SMILES:F[C@@H]1C[C@H](N)C1
Synonyms:- cis-3-Fluorocyclobutanamine
- Cyclobutanamine, 3-fluoro-, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.