CAS 1260671-58-6

Ethyl 1,2,4-triazine-6-carboxylate

Description:

Ethyl 1,2,4-triazine-6-carboxylate is a chemical compound characterized by its triazine ring structure, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Ethyl 1,2,4-triazine-6-carboxylate is often studied for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its unique structure allows for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, warranting further investigation into its properties and potential uses.

Formula: C₆H₇N₃O₂

InChI: InChI=1S/C6H7N3O2/c1-2-11-6(10)5-3-7-4-8-9-5/h3-4H,2H2,1H3

InChI key: InChIKey=ZQFMUFONNBAZAY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=NC=NN1

Synonyms:

• 1,2,4-Triazine-6-carboxylic acid, ethyl ester
• Ethyl 1,2,4-triazine-6-carboxylate