CAS 1260672-08-9

6-(Chloromethyl)-2-fluoro-3-methylpyridine

Description:

6-(Chloromethyl)-2-fluoro-3-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a chloromethyl group and a fluorine atom. The presence of the chloromethyl group at the 6-position and a fluorine atom at the 2-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits a polar nature due to the electronegative fluorine and chlorine substituents, which can influence its solubility in various solvents. The methyl group at the 3-position adds to the steric bulk and can affect the compound's overall reactivity and interaction with biological targets. As a pyridine derivative, it may participate in nucleophilic substitution reactions, making it valuable in the synthesis of more complex molecules. Its specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular structure and the environment in which it is studied. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₇H₇ClFN

InChI: InChI=1S/C7H7ClFN/c1-5-2-3-6(4-8)10-7(5)9/h2-3H,4H2,1H3

InChI key: InChIKey=UCOHJCIVXTVVLS-UHFFFAOYSA-N

SMILES: C(Cl)C=1N=C(F)C(C)=CC1

Synonyms:

• 6-(Chloromethyl)-2-fluoro-3-methylpyridine
• Pyridine, 6-(chloromethyl)-2-fluoro-3-methyl-