CAS 1260672-10-3

5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazole-3-methanamine

Description:

5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazole-3-methanamine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyrazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential reactivity due to the presence of amine functional groups. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its nitrogen-rich structure. The presence of the methanamine group can enhance its ability to form hydrogen bonds, influencing its biological activity and solubility. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. As with many heterocycles, the stability and reactivity can vary based on substituents and environmental conditions, making it a subject of interest for further research in organic synthesis and drug development.

Formula: C₇H₁₁N₃

InChI: InChI=1S/C7H11N3/c8-4-6-5-9-10-3-1-2-7(6)10/h5H,1-4,8H2

InChI key: InChIKey=YBQHCOCESJJECE-UHFFFAOYSA-N

SMILES: C(N)C1=C2N(N=C1)CCC2

Synonyms:

• 5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazole-3-methanamine
• 4H-Pyrrolo[1,2-b]pyrazole-3-methanamine, 5,6-dihydro-
• [4H,5H,6H-Pyrrolo[1,2-b]pyrazol-3-yl]methanamine

(5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)methanamine

CAS: 1260672-10-3

Formula: C₇H₁₁N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 137.1823

Ref: IN-DA01K0F2

(5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)methanamine

CAS: 1260672-10-3

(5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)methanamine

Purity: 97%

Molecular weight: 137.19g/mol

Ref: 54-OR1068618

(5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)methanamine

CAS: 1260672-10-3

Purity: 97%

Molecular weight: 137.1860046

Ref: 10-F603756