
CAS 1260672-53-4
:5-Methoxy-2-(2-propyn-1-yl)pyridine
Description:
5-Methoxy-2-(2-propyn-1-yl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 5-position and a propynyl group (a three-carbon chain with a triple bond) at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the methoxy group, which can engage in hydrogen bonding and influence solubility in various solvents. Its structure suggests potential reactivity typical of alkynes and aromatic compounds, making it of interest in synthetic organic chemistry. Additionally, the presence of the nitrogen atom in the pyridine ring may impart basicity and influence the compound's interaction with other chemical species. While specific applications may vary, compounds of this type are often explored in medicinal chemistry and material science for their potential biological activities and functional properties.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c1-3-4-8-5-6-9(11-2)7-10-8/h1,5-7H,4H2,2H3
InChI key:InChIKey=RPFUPFZYWCCKBW-UHFFFAOYSA-N
SMILES:C(C#C)C1=CC=C(OC)C=N1
Synonyms:- Pyridine, 5-methoxy-2-(2-propyn-1-yl)-
- 5-Methoxy-2-(2-propyn-1-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.