CAS 1260672-54-5

1-Iodo-3-(2-propyn-1-yl)benzene

Description:

1-Iodo-3-(2-propyn-1-yl)benzene is an organic compound characterized by the presence of an iodine atom and a propynyl group attached to a benzene ring. The structure features a benzene core with an iodine substituent at the 1-position and a propynyl group at the 3-position, which contributes to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased reactivity in nucleophilic substitution reactions due to the presence of the iodine atom. Additionally, the alkyne functionality in the propynyl group may allow for further chemical transformations, including coupling reactions. The compound's physical properties, such as boiling point and solubility, would depend on the specific molecular interactions and the presence of the iodine atom, which can influence polarity. Overall, 1-Iodo-3-(2-propyn-1-yl)benzene serves as a valuable intermediate in the synthesis of more complex organic molecules in the field of medicinal chemistry and materials science.

Formula: C₉H₇I

InChI: InChI=1S/C9H7I/c1-2-4-8-5-3-6-9(10)7-8/h1,3,5-7H,4H2

InChI key: InChIKey=JKKAWRRKOQLXJB-UHFFFAOYSA-N

SMILES: C(C#C)C1=CC(I)=CC=C1

Synonyms:

• 1-Iodo-3-(2-propyn-1-yl)benzene
• Benzene, 1-iodo-3-(2-propyn-1-yl)-