CAS 1260672-55-6

7-Bromo-5-chloro-3H-imidazo[4,5-b]pyridine

Description:

7-Bromo-5-chloro-3H-imidazo[4,5-b]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at specific positions enhances its reactivity and potential biological activity. This compound typically exhibits a pale to dark solid appearance and is soluble in organic solvents, reflecting its polar nature due to the nitrogen atoms in the ring structure. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing effects of the halogen substituents. Additionally, compounds of this class are often investigated for their pharmacological properties, including antimicrobial and anticancer activities. The molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 7-Bromo-5-chloro-3H-imidazo[4,5-b]pyridine represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₆H₃BrClN₃

InChI: InChI=1S/C6H3BrClN3/c7-3-1-4(8)11-6-5(3)9-2-10-6/h1-2H,(H,9,10,11)

InChI key: InChIKey=FJIIDSKKIYCOIF-UHFFFAOYSA-N

SMILES: BrC1=C2C(=NC(Cl)=C1)N=CN2

Synonyms:

• 3H-Imidazo[4,5-b]pyridine, 7-bromo-5-chloro-
• 7-Bromo-5-chloro-3H-imidazo[4,5-b]pyridine