
CAS 1260672-65-8
:3,8-Dichloro-1,7-naphthyridine
Description:
3,8-Dichloro-1,7-naphthyridine is a heterocyclic organic compound characterized by a fused bicyclic structure containing nitrogen atoms. It features two chlorine substituents at the 3 and 8 positions of the naphthyridine ring system, which contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. The presence of chlorine atoms can enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, 3,8-Dichloro-1,7-naphthyridine may serve as a precursor or intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structure and properties make it a subject of interest in various chemical research fields.
Formula:C8H4Cl2N2
InChI:InChI=1S/C8H4Cl2N2/c9-6-3-5-1-2-11-8(10)7(5)12-4-6/h1-4H
InChI key:InChIKey=MBOAAZGQONXYSS-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(Cl)C=N2)C=CN1
Synonyms:- 3,8-Dichloro-1,7-naphthyridine
- 1,7-Naphthyridine, 3,8-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.