CAS 1260674-56-3

2-(Bromomethyl)-3-fluorophenol

Description:

2-(Bromomethyl)-3-fluorophenol is an organic compound characterized by the presence of a bromomethyl group and a fluorine atom attached to a phenolic structure. This compound features a phenol ring, which is a benzene ring with a hydroxyl (-OH) group, and it is substituted at the 2-position with a bromomethyl group (-CH2Br) and at the 3-position with a fluorine atom (-F). The presence of these halogen substituents can significantly influence the compound's reactivity, polarity, and potential applications in organic synthesis or medicinal chemistry. The bromomethyl group can serve as a reactive site for further chemical transformations, while the fluorine atom may enhance the compound's lipophilicity and biological activity. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the interactions between the halogen substituents and the hydroxyl group. Overall, 2-(Bromomethyl)-3-fluorophenol is of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features.

Formula: C₇H₆BrFO

InChI: InChI=1S/C7H6BrFO/c8-4-5-6(9)2-1-3-7(5)10/h1-3,10H,4H2

InChI key: InChIKey=ZDBXQBYTTFZHJP-UHFFFAOYSA-N

SMILES: C(Br)C1=C(F)C=CC=C1O

Synonyms:

• 2-(Bromomethyl)-3-fluorophenol
• Phenol, 2-(bromomethyl)-3-fluoro-