CAS 1260675-01-1

4-(Chloromethyl)-2-(2-iodophenyl)-5-methyloxazole

Description:

4-(Chloromethyl)-2-(2-iodophenyl)-5-methyloxazole is a chemical compound characterized by its unique structure, which includes an oxazole ring, a chloromethyl group, and a 2-iodophenyl substituent. The presence of the oxazole ring indicates that it possesses both nitrogen and oxygen in its five-membered aromatic structure, contributing to its potential reactivity and biological activity. The chloromethyl group can serve as a reactive site for further chemical modifications, while the iodine atom in the phenyl group may enhance the compound's lipophilicity and influence its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would depend on the specific conditions under which it is handled. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₁₁H₉ClINO

InChI: InChI=1S/C11H9ClINO/c1-7-10(6-12)14-11(15-7)8-4-2-3-5-9(8)13/h2-5H,6H2,1H3

InChI key: InChIKey=MWEHRRBAQUOCLK-UHFFFAOYSA-N

SMILES: IC1=C(C2=NC(CCl)=C(C)O2)C=CC=C1

Synonyms:

• 4-(Chloromethyl)-2-(2-iodophenyl)-5-methyloxazole
• Oxazole, 4-(chloromethyl)-2-(2-iodophenyl)-5-methyl-