
CAS 1260675-08-8
:3-(2-Bromoethyl)-5-methyl-1H-indole
Description:
3-(2-Bromoethyl)-5-methyl-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromoethyl group at the 3-position and a methyl group at the 5-position of the indole ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its bromine atom can serve as a site for nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, the indole moiety is known for its biological activity, often found in various natural products and pharmaceuticals. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C11H12BrN
InChI:InChI=1S/C11H12BrN/c1-8-2-3-11-10(6-8)9(4-5-12)7-13-11/h2-3,6-7,13H,4-5H2,1H3
InChI key:InChIKey=MRDJFDQVUHMPBU-UHFFFAOYSA-N
SMILES:C(CBr)C=1C=2C(NC1)=CC=C(C)C2
Synonyms:- 1H-Indole, 3-(2-bromoethyl)-5-methyl-
- 3-(2-Bromoethyl)-5-methyl-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
