CymitQuimica logo

CAS 1260683-21-3

:

7-(Trifluoromethyl)pyrido[2,3-b]pyrazine

Description:
7-(Trifluoromethyl)pyrido[2,3-b]pyrazine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrazine rings. The presence of a trifluoromethyl group (-CF3) at the 7-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically colorless to pale yellow and may exhibit moderate to high stability under standard conditions. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of novel compounds with specific biological activities. The trifluoromethyl group is known to impart unique electronic properties, making the compound of interest in medicinal chemistry for the design of targeted therapies. Additionally, the compound's reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group, which may affect its interactions with other chemical species. Overall, 7-(Trifluoromethyl)pyrido[2,3-b]pyrazine is a valuable compound in various fields of research due to its distinctive structural and electronic characteristics.
Formula:C8H4F3N3
InChI:InChI=1S/C8H4F3N3/c9-8(10,11)5-3-6-7(14-4-5)13-2-1-12-6/h1-4H
InChI key:InChIKey=MWAIGTKEYOCQAF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC2=C(N=C1)N=CC=N2
Synonyms:
  • 7-(Trifluoromethyl)pyrido[2,3-b]pyrazine
  • Pyrido[2,3-b]pyrazine, 7-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.