
CAS 126069-76-9
:2-[(Phenylamino)carbonyl]benzeneacetic acid
Description:
2-[(Phenylamino)carbonyl]benzeneacetic acid, also known by its CAS number 126069-76-9, is an organic compound characterized by its structure, which features a benzeneacetic acid moiety substituted with a phenylamino group. This compound typically exhibits properties associated with both aromatic amines and carboxylic acids, including potential solubility in polar solvents due to the presence of the carboxylic acid functional group. It may display moderate to high melting points, depending on its crystalline structure and purity. The presence of the phenylamino group suggests potential for hydrogen bonding and interactions with biological systems, which could influence its reactivity and biological activity. Additionally, this compound may exhibit acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. Its specific applications and behavior in biological systems would depend on further studies, particularly in pharmacology or material science, where such compounds may serve as intermediates or active pharmaceutical ingredients.
Formula:C15H13NO3
InChI:InChI=1S/C15H13NO3/c17-14(18)10-11-6-4-5-9-13(11)15(19)16-12-7-2-1-3-8-12/h1-9H,10H2,(H,16,19)(H,17,18)
InChI key:InChIKey=OHPBHIFNOJKRNJ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(C(NC2=CC=CC=C2)=O)C=CC=C1
Synonyms:- (2-Phenylcarbamoyl-phenyl)-acetic acid
- Benzeneacetic acid, 2-[(phenylamino)carbonyl]-
- 2-[(Phenylamino)carbonyl]benzeneacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
