CAS 1260741-05-6

5-Bromo-3-fluoro-2-pyridineethanamine

Description:

5-Bromo-3-fluoro-2-pyridineethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with bromine and fluorine atoms, as well as an ethylamine side chain. This compound is typically classified as an amine due to the presence of the amino group (-NH2) attached to the ethyl chain. The bromine and fluorine substituents contribute to its reactivity and influence its physical properties, such as solubility and boiling point. The presence of halogens often enhances the compound's biological activity, making it of interest in pharmaceutical research and development. Additionally, the pyridine ring is known for its aromaticity, which can affect the compound's stability and interaction with other molecules. Overall, 5-Bromo-3-fluoro-2-pyridineethanamine is a versatile compound with potential applications in medicinal chemistry, particularly in the design of new therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would require empirical data for precise evaluation.

Formula: C₇H₈BrFN₂

InChI: InChI=1S/C7H8BrFN2/c8-5-3-6(9)7(1-2-10)11-4-5/h3-4H,1-2,10H2

InChI key: InChIKey=FRQYXUJUXGSCAP-UHFFFAOYSA-N

SMILES: C(CN)C1=C(F)C=C(Br)C=N1

Synonyms:

• 5-Bromo-3-fluoro-2-pyridineethanamine
• 2-Pyridineethanamine, 5-bromo-3-fluoro-