CAS 1260741-41-0

1-[3-(Trifluoromethoxy)phenyl]cyclopropanecarboxylic acid

Description:

1-[3-(Trifluoromethoxy)phenyl]cyclopropanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a trifluoromethoxy group attached to a phenyl ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The cyclopropanecarboxylic acid moiety suggests potential acidity, which can play a role in its interactions with biological targets. Additionally, the trifluoromethoxy group can impart unique electronic properties, affecting the compound's overall reactivity and solubility in various solvents. Overall, this compound's distinctive structure and functional groups make it a subject of interest in organic synthesis and medicinal chemistry, where it may serve as a building block for more complex molecules or as a lead compound in drug development.

Formula: C₁₁H₉F₃O₃

InChI: InChI=1S/C11H9F3O3/c12-11(13,14)17-8-3-1-2-7(6-8)10(4-5-10)9(15)16/h1-3,6H,4-5H2,(H,15,16)

InChI key: InChIKey=KWULESULVXCFJM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(OC(F)(F)F)=CC=C2

Synonyms:

• Cyclopropanecarboxylic acid, 1-[3-(trifluoromethoxy)phenyl]-
• 1-[3-(Trifluoromethoxy)phenyl]cyclopropanecarboxylic acid

1-[3-(Trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid

CAS: 1260741-41-0

Versatile small molecule scaffold

Formula: C₁₁H₉F₃O₃

Purity: Min. 95%

Molecular weight: 246.18 g/mol

Ref: 3D-KAC74141