CAS 1260742-24-2

Methyl 6-[[(1,1-dimethylethoxy)carbonyl]amino]-3-pyridineacetate

Description:

Methyl 6-[[(1,1-dimethylethoxy)carbonyl]amino]-3-pyridineacetate is a chemical compound characterized by its complex structure, which includes a pyridine ring, an ester functional group, and an amine moiety. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a bulky protective group, which can influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic (aromatic and aliphatic) and hydrophilic (ester and amine) functional groups. It may participate in various chemical reactions, including nucleophilic substitutions and hydrolysis, depending on the conditions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often found in biologically active molecules. Additionally, its solubility characteristics may make it suitable for formulation in various solvents, enhancing its utility in chemical synthesis and research.

Formula: C₁₃H₁₈N₂O₄

InChI: InChI=1S/C13H18N2O4/c1-13(2,3)19-12(17)15-10-6-5-9(8-14-10)7-11(16)18-4/h5-6,8H,7H2,1-4H3,(H,14,15,17)

InChI key: InChIKey=INQQQFHWJJNACY-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=CC=C(CC(OC)=O)C=N1

Synonyms:

• 3-Pyridineacetic acid, 6-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester
• (6-tert-Butoxycarbonylamino-pyridin-3-yl)-acetic acid methyl ester
• Methyl 6-[[(1,1-dimethylethoxy)carbonyl]amino]-3-pyridineacetate

3-Pyridineacetic acid, 6-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester

CAS: 1260742-24-2

Formula: C₁₃H₁₈N₂O₄

Molecular weight: 266.293

Ref: IN-DA000R44