
CAS 1260752-03-1
:2-(3-Azetidinyl)-1-methyl-1H-indole
Description:
2-(3-Azetidinyl)-1-methyl-1H-indole, identified by its CAS number 1260752-03-1, is a chemical compound that features a unique structure combining an indole moiety with an azetidine ring. The indole part contributes to its aromatic properties and potential biological activity, while the azetidine ring introduces a cyclic amine structure that can influence its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or as a scaffold for synthesizing other bioactive molecules. The presence of both nitrogen-containing rings may also affect its solubility, stability, and overall bioavailability. As with many compounds in this category, further studies would be necessary to fully elucidate its characteristics, including its synthesis, mechanism of action, and potential therapeutic uses.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c1-14-11-5-3-2-4-9(11)6-12(14)10-7-13-8-10/h2-6,10,13H,7-8H2,1H3
InChI key:InChIKey=CTSZSWHZPRUCDU-UHFFFAOYSA-N
SMILES:CN1C(=CC=2C1=CC=CC2)C3CNC3
Synonyms:- 2-(3-Azetidinyl)-1-methyl-1H-indole
- 1H-Indole, 2-(3-azetidinyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.