CymitQuimica logo

CAS 1260759-22-5

:

N3,N3-Dimethyl-1,3-piperidinediamine

Description:
N3,N3-Dimethyl-1,3-piperidinediamine, with the CAS number 1260759-22-5, is an organic compound characterized by its piperidine structure, which features a six-membered ring containing nitrogen atoms. This compound has two dimethylamino groups attached to the piperidine ring, contributing to its basicity and potential reactivity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of multiple amine groups suggests that it can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its solubility in polar solvents, such as water and alcohols, is notable, which enhances its utility in various applications, including as a building block in organic synthesis and potential use in pharmaceuticals. Safety data should be consulted, as amines can be hazardous, and appropriate handling procedures are necessary to mitigate risks associated with exposure.
Formula:C7H17N3
InChI:InChI=1S/C7H17N3/c1-9(2)7-4-3-5-10(8)6-7/h7H,3-6,8H2,1-2H3
InChI key:InChIKey=DDNJPHJFFSPJQG-UHFFFAOYSA-N
SMILES:N(C)(C)C1CN(N)CCC1
Synonyms:
  • 1,3-Piperidinediamine, N3,N3-dimethyl-
  • 3-N,3-N-Dimethylpiperidine-1,3-diamine
  • N3,N3-Dimethyl-1,3-piperidinediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.