CAS 1260759-88-3

Ethyl 4-cyano-4-[[(phenylmethoxy)carbonyl]amino]cyclohexanecarboxylate

Description:

Ethyl 4-cyano-4-[[(phenylmethoxy)carbonyl]amino]cyclohexanecarboxylate is a synthetic organic compound characterized by its complex structure, which includes a cyclohexane ring, a cyano group, and an ethyl ester functional group. This compound features a phenylmethoxycarbonyl moiety, which contributes to its potential applications in medicinal chemistry and organic synthesis. The presence of the cyano group indicates potential reactivity, making it a candidate for further chemical transformations. The ethyl ester group suggests that the compound may exhibit moderate lipophilicity, influencing its solubility and bioavailability. Additionally, the amino group in the structure may participate in hydrogen bonding, affecting its interaction with biological targets. Overall, this compound's unique combination of functional groups positions it as a versatile intermediate in the development of pharmaceuticals or agrochemicals, although specific biological activities and properties would require further investigation through experimental studies.

Formula: C₁₈H₂₂N₂O₄

InChI: InChI=1S/C18H22N2O4/c1-2-23-16(21)15-8-10-18(13-19,11-9-15)20-17(22)24-12-14-6-4-3-5-7-14/h3-7,15H,2,8-12H2,1H3,(H,20,22)

InChI key: InChIKey=PZSRAJWHKBTAML-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C2(C#N)CCC(C(OCC)=O)CC2

Synonyms:

• Cyclohexanecarboxylic acid, 4-cyano-4-[[(phenylmethoxy)carbonyl]amino]-, ethyl ester
• Ethyl 4-cyano-4-[[(phenylmethoxy)carbonyl]amino]cyclohexanecarboxylate

Cyclohexanecarboxylic acid, 4-cyano-4-[[(phenylmethoxy)carbonyl]amino]-, ethyl ester

CAS: 1260759-88-3

Formula: C₁₈H₂₂N₂O₄

Molecular weight: 330.3783

Ref: IN-DA000R4E