CAS 1260761-22-5
:2,4-Dichlorobenzenebutanenitrile
Description:
2,4-Dichlorobenzenebutanenitrile, identified by its CAS number 1260761-22-5, is a chemical compound characterized by its structure, which includes a butanenitrile group attached to a dichlorobenzene moiety. This compound typically exhibits a crystalline solid form and is known for its aromatic properties due to the presence of the benzene ring. The dichlorination introduces two chlorine atoms at the 2 and 4 positions of the benzene ring, which can influence its reactivity and physical properties, such as solubility and boiling point. 2,4-Dichlorobenzenebutanenitrile may be utilized in various chemical syntheses and applications, particularly in the field of agrochemicals or pharmaceuticals. Its toxicity and environmental impact should be considered, as halogenated compounds can exhibit significant biological activity. Proper handling and safety measures are essential when working with this substance, as it may pose health risks if inhaled, ingested, or absorbed through the skin.
Formula:C10H9Cl2N
InChI:InChI=1S/C10H9Cl2N/c11-9-5-4-8(10(12)7-9)3-1-2-6-13/h4-5,7H,1-3H2
InChI key:InChIKey=RNVYCRVSHYCBDP-UHFFFAOYSA-N
SMILES:C(CCC#N)C1=C(Cl)C=C(Cl)C=C1
Synonyms:- Benzenebutanenitrile, 2,4-dichloro-
- 2,4-Dichlorobenzenebutanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
