
CAS 1260761-67-8
:2-(3,4-Difluorophenyl)cyclopentanone
Description:
2-(3,4-Difluorophenyl)cyclopentanone is an organic compound characterized by its cyclopentanone structure, which features a cyclopentane ring with a ketone functional group. The presence of a 3,4-difluorophenyl substituent indicates that the compound has two fluorine atoms attached to a phenyl ring at the 3 and 4 positions, influencing its chemical reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms, which can also enhance its lipophilicity. The ketone functional group contributes to its potential reactivity in nucleophilic addition reactions. Additionally, the presence of fluorine can affect the compound's stability, boiling point, and solubility in various solvents. As with many fluorinated compounds, it may also exhibit unique biological activity, making it of interest in pharmaceutical research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C11H10F2O
InChI:InChI=1S/C11H10F2O/c12-9-5-4-7(6-10(9)13)8-2-1-3-11(8)14/h4-6,8H,1-3H2
InChI key:InChIKey=RKZZBEHJOBFDGK-UHFFFAOYSA-N
SMILES:O=C1C(CCC1)C2=CC(F)=C(F)C=C2
Synonyms:- 2-(3,4-Difluorophenyl)cyclopentanone
- Cyclopentanone, 2-(3,4-difluorophenyl)-
- 2-(3,4-Difluorophenyl)cyclopentan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.