CAS 1260766-07-1

3-(5-Bromo-2-furanyl)piperidine

Description:

3-(5-Bromo-2-furanyl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a 5-bromo-2-furanyl substituent. The presence of the bromine atom introduces notable reactivity and can influence the compound's biological activity. The furan ring contributes to the compound's aromatic properties, enhancing its potential interactions in various chemical environments. This compound is typically classified as a heterocyclic amine due to the nitrogen atom in the piperidine ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit interesting pharmacological properties. Additionally, the bromine substituent can serve as a useful handle for further chemical modifications, allowing for the synthesis of derivatives with tailored activities. Overall, 3-(5-Bromo-2-furanyl)piperidine represents a versatile scaffold in organic synthesis and drug discovery, with characteristics that warrant further investigation into its chemical behavior and potential applications.

Formula: C₉H₁₂BrNO

InChI: InChI=1S/C9H12BrNO/c10-9-4-3-8(12-9)7-2-1-5-11-6-7/h3-4,7,11H,1-2,5-6H2

InChI key: InChIKey=VETVZNXZBJPXSU-UHFFFAOYSA-N

SMILES: BrC=1OC(=CC1)C2CCCNC2

Synonyms:

• Piperidine, 3-(5-bromo-2-furanyl)-
• 3-(5-Bromo-2-furanyl)piperidine