CAS 1260773-43-0

2-Chloro-1-(5-isoquinolinyl)ethanone

Description:

2-Chloro-1-(5-isoquinolinyl)ethanone is a chemical compound characterized by its unique structure, which includes a chloro group and an isoquinoline moiety. The presence of the chloro substituent typically enhances the compound's reactivity, making it useful in various synthetic applications. The isoquinoline ring contributes to the compound's aromaticity and can influence its biological activity, as isoquinolines are known for their presence in numerous natural products and pharmaceuticals. This compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets, which could be of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many synthetic organic compounds, safety and handling precautions should be observed due to the presence of the chloro group, which can pose hazards. Overall, 2-Chloro-1-(5-isoquinolinyl)ethanone represents a valuable compound for research and development in various chemical and pharmaceutical contexts.

Formula: C₁₁H₈ClNO

InChI: InChI=1S/C11H8ClNO/c12-6-11(14)10-3-1-2-8-7-13-5-4-9(8)10/h1-5,7H,6H2

InChI key: InChIKey=WEIPREBIENJFAV-UHFFFAOYSA-N

SMILES: C(CCl)(=O)C=1C2=C(C=CC1)C=NC=C2

Synonyms:

• 2-Chloro-1-(5-isoquinolinyl)ethanone
• Ethanone, 2-chloro-1-(5-isoquinolinyl)-