CymitQuimica logo

CAS 1260774-01-3

:

1H-1,2,3-Triazole-4-carboxamide, 1-(4-piperidinylmethyl)-, hydrochloride (1:1)

Description:
1H-1,2,3-Triazole-4-carboxamide, 1-(4-piperidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of a piperidine moiety indicates that it may exhibit pharmacological properties, as piperidine derivatives are often associated with various biological activities. The hydrochloride salt form enhances its solubility in water, making it suitable for pharmaceutical applications. The compound's molecular structure suggests it may interact with biological targets, potentially influencing enzymatic or receptor activities. Its CAS number, 1260774-01-3, allows for precise identification in chemical databases. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in medicinal chemistry and drug development.
Formula:C9H15N5O·ClH
InChI:InChI=1S/C9H15N5O.ClH/c10-9(15)8-6-14(13-12-8)5-7-1-3-11-4-2-7;/h6-7,11H,1-5H2,(H2,10,15);1H
InChI key:InChIKey=OCJUQLSMWAFSKG-UHFFFAOYSA-N
SMILES:C(N1C=C(C(N)=O)N=N1)C2CCNCC2.Cl
Synonyms:
  • 1H-1,2,3-Triazole-4-carboxamide, 1-(4-piperidinylmethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.