CAS 1260778-46-8

Ethyl 6-chloro-4-(trifluoromethyl)-3-pyridinecarboxylate

Description:

Ethyl 6-chloro-4-(trifluoromethyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the 6-position and a trifluoromethyl group at the 4-position of the pyridine ring, contributing to its unique chemical properties. The ethyl ester functional group at the 3-position enhances its reactivity and solubility in organic solvents. The presence of the trifluoromethyl group is notable for imparting strong electron-withdrawing characteristics, which can influence the compound's reactivity and interaction with other chemical species. This compound is likely to be of interest in medicinal chemistry and agrochemical applications due to its potential biological activity and ability to modify molecular interactions. Additionally, its specific structural features may allow for various synthetic transformations, making it a valuable intermediate in organic synthesis. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity and environmental impact.

Formula: C₉H₇ClF₃NO₂

InChI: InChI=1S/C9H7ClF3NO2/c1-2-16-8(15)5-4-14-7(10)3-6(5)9(11,12)13/h3-4H,2H2,1H3

InChI key: InChIKey=DSPKVBDBUNEDFL-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(C(F)(F)F)=CC(Cl)=NC1

Synonyms:

• 3-Pyridinecarboxylic acid, 6-chloro-4-(trifluoromethyl)-, ethyl ester
• Ethyl 6-chloro-4-(trifluoromethyl)-3-pyridinecarboxylate