
CAS 1260778-47-9
:2-(3-Azetidinyl)-4-fluorophenol
Description:
2-(3-Azetidinyl)-4-fluorophenol is a chemical compound characterized by its unique structure, which includes a fluorophenol moiety and an azetidine ring. The presence of the fluorine atom at the para position of the phenolic ring enhances its reactivity and can influence its biological activity. The azetidine ring, a four-membered nitrogen-containing heterocycle, contributes to the compound's potential pharmacological properties. This compound may exhibit various characteristics such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological targets due to its functional groups. Its molecular structure suggests that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The specific properties, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. As with many compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be assessed in detail for any practical applications.
Formula:C9H10FNO
InChI:InChI=1S/C9H10FNO/c10-7-1-2-9(12)8(3-7)6-4-11-5-6/h1-3,6,11-12H,4-5H2
InChI key:InChIKey=RBNHSSYFZWLGMG-UHFFFAOYSA-N
SMILES:OC1=C(C=C(F)C=C1)C2CNC2
Synonyms:- Phenol, 2-(3-azetidinyl)-4-fluoro-
- 2-(3-Azetidinyl)-4-fluorophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.