CymitQuimica logo

CAS 1260780-24-2

:

3-(2-Fluoro-4-nitrophenyl)azetidine

Description:
3-(2-Fluoro-4-nitrophenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a 2-fluoro-4-nitrophenyl group indicates that the compound has a fluorine atom and a nitro group attached to a phenyl ring, which can influence its reactivity and biological activity. The fluorine atom often enhances lipophilicity and metabolic stability, while the nitro group can serve as a potential electrophile in various chemical reactions. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the phenyl ring, which are critical for understanding its behavior in different chemical environments. Overall, 3-(2-Fluoro-4-nitrophenyl)azetidine represents a unique structure with potential implications in various fields of chemistry and pharmacology.
Formula:C9H9FN2O2
InChI:InChI=1S/C9H9FN2O2/c10-9-3-7(12(13)14)1-2-8(9)6-4-11-5-6/h1-3,6,11H,4-5H2
InChI key:InChIKey=ZDIPBWDETSDETQ-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(N(=O)=O)=C1)C2CNC2
Synonyms:
  • 3-(2-Fluoro-4-nitrophenyl)azetidine
  • Azetidine, 3-(2-fluoro-4-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.