CAS 1260780-99-1

1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclopropanecarboxylic acid

Description:

1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a carboxylic acid functional group. The presence of a trifluoromethyl group and a fluorine atom on the phenyl ring contributes to its distinctive electronic properties, potentially enhancing its reactivity and solubility in various solvents. This compound may exhibit interesting biological activities due to its fluorinated substituents, which can influence lipophilicity and metabolic stability. The cyclopropane moiety often imparts strain, which can lead to increased reactivity in certain chemical reactions. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals where fluorinated compounds are known to improve drug-like properties. As with many fluorinated compounds, it is essential to consider environmental and safety aspects during handling and disposal. Overall, this compound represents a significant interest in both synthetic and applied chemistry fields.

Formula: C₁₁H₈F₄O₂

InChI: InChI=1S/C11H8F4O2/c12-8-4-6(10(1-2-10)9(16)17)3-7(5-8)11(13,14)15/h3-5H,1-2H2,(H,16,17)

InChI key: InChIKey=UHHHXFUMRLHTJJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(C(F)(F)F)=CC(F)=C2

Synonyms:

• Cyclopropanecarboxylic acid, 1-[3-fluoro-5-(trifluoromethyl)phenyl]-
• 1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclopropanecarboxylic acid

1-[3-Fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid

CAS: 1260780-99-1

Versatile small molecule scaffold

Formula: C₁₁H₈F₄O₂

Purity: Min. 95%

Molecular weight: 248.17 g/mol

Ref: 3D-KAC78099