CAS 1260781-00-7

2-Methoxy-3-(4-piperidinyl)quinoline

Description:

2-Methoxy-3-(4-piperidinyl)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a methoxy group at the 2-position and a piperidine substituent at the 3-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. It is of interest in medicinal chemistry, potentially serving as a lead compound in drug development due to its structural features that may interact with biological targets. The piperidine moiety can enhance its pharmacological profile by improving binding affinity to certain receptors. Additionally, the compound may exhibit various biological activities, including antimicrobial or antitumor properties, although specific activities would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₅H₁₈N₂O

InChI: InChI=1S/C15H18N2O/c1-18-15-13(11-6-8-16-9-7-11)10-12-4-2-3-5-14(12)17-15/h2-5,10-11,16H,6-9H2,1H3

InChI key: InChIKey=JJOAAKQPUOJQFV-UHFFFAOYSA-N

SMILES: O(C)C=1C(=CC2=C(N1)C=CC=C2)C3CCNCC3

Synonyms:

• 2-Methoxy-3-(4-piperidinyl)quinoline
• Quinoline, 2-methoxy-3-(4-piperidinyl)-