CymitQuimica logo

CAS 1260784-01-7

:

(4,6-Dichloro-5-pyrimidinyl)[4-methoxy-2-(trifluoromethyl)phenyl]methanone

Description:
(4,6-Dichloro-5-pyrimidinyl)[4-methoxy-2-(trifluoromethyl)phenyl]methanone is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring substituted with chlorine atoms and a methanone functional group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is typically used in pharmaceutical research and development, particularly in the design of potential therapeutic agents. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The dichloro and trifluoromethyl substituents can significantly affect the compound's reactivity, stability, and solubility, which are critical factors in drug formulation. Additionally, the methoxy group may contribute to the compound's electronic properties, influencing its overall behavior in biological systems. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C13H7Cl2F3N2O2
InChI:InChI=1S/C13H7Cl2F3N2O2/c1-22-6-2-3-7(8(4-6)13(16,17)18)10(21)9-11(14)19-5-20-12(9)15/h2-5H,1H3
InChI key:InChIKey=QDELQDTYZKHHLQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(F)(F)F)C=C(OC)C=C1)C=2C(Cl)=NC=NC2Cl
Synonyms:
  • (4,6-Dichloro-5-pyrimidinyl)[4-methoxy-2-(trifluoromethyl)phenyl]methanone
  • Methanone, (4,6-dichloro-5-pyrimidinyl)[4-methoxy-2-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.