CAS 1260790-31-5

Hydrazine, (5-fluoro-2-methoxyphenyl)-, hydrochloride (1:1)

Description:

Hydrazine, (5-fluoro-2-methoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its hydrazine functional group, which is known for its reactivity and use in various applications, including as a reducing agent and in the synthesis of pharmaceuticals. The presence of the 5-fluoro-2-methoxyphenyl moiety indicates that the compound has a fluorine atom and a methoxy group attached to a phenyl ring, which can influence its chemical properties, such as solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit biological activity, making it of interest in medicinal chemistry. However, hydrazine derivatives can also pose health risks, including toxicity and potential carcinogenicity, necessitating careful handling and safety precautions in laboratory and industrial settings. Overall, this compound's unique structure and properties make it a subject of interest in both research and application contexts.

Formula: C₇H₉FN₂O·ClH

InChI: InChI=1S/C7H9FN2O.ClH/c1-11-7-3-2-5(8)4-6(7)10-9;/h2-4,10H,9H2,1H3;1H

InChI key: InChIKey=IRBGDXSCTKFYBU-UHFFFAOYSA-N

SMILES: O(C)C1=C(NN)C=C(F)C=C1.Cl

Synonyms:

• Hydrazine, (5-fluoro-2-methoxyphenyl)-, hydrochloride (1:1)

Hydrazine, (5-fluoro-2-methoxyphenyl)-, hydrochloride (1:1)

CAS: 1260790-31-5

Formula: C₇H₁₀ClFN₂O

Molecular weight: 192.6185

Ref: IN-DA000RAE