CAS 1260790-54-2

2,4,5-Trifluoro-3-hydroxybenzenemethanol

Description:

2,4,5-Trifluoro-3-hydroxybenzenemethanol is an organic compound characterized by the presence of a benzene ring substituted with three fluorine atoms and a hydroxymethyl group. The trifluoromethyl groups at the 2, 4, and 5 positions significantly influence its chemical properties, enhancing its hydrophobicity and potentially altering its reactivity compared to non-fluorinated analogs. The hydroxyl group (-OH) contributes to its polarity, making it capable of forming hydrogen bonds, which can affect its solubility in various solvents. This compound may exhibit interesting biological activity due to the presence of both the fluorinated groups and the hydroxyl moiety, which can interact with biological targets. Additionally, the trifluoromethyl groups can enhance metabolic stability and lipophilicity, making it a candidate for pharmaceutical applications. Its synthesis and handling require careful consideration due to the reactivity of fluorinated compounds and the potential environmental impact of fluorinated substances. Overall, 2,4,5-Trifluoro-3-hydroxybenzenemethanol represents a unique structure with potential applications in medicinal chemistry and materials science.

Formula: C₇H₅F₃O₂

InChI: InChI=1S/C7H5F3O2/c8-4-1-3(2-11)5(9)7(12)6(4)10/h1,11-12H,2H2

InChI key: InChIKey=YEZTUUORFVUFCM-UHFFFAOYSA-N

SMILES: C(O)C1=C(F)C(O)=C(F)C(F)=C1

Synonyms:

• 2,4,5-Trifluoro-3-hydroxybenzenemethanol
• Benzenemethanol, 2,4,5-trifluoro-3-hydroxy-