CAS 1260790-76-8
:1-(4-Chloro-3-fluorophenyl)cyclopropanamine
Description:
1-(4-Chloro-3-fluorophenyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring attached to an amine group and a substituted phenyl group. The presence of a chlorine atom and a fluorine atom on the phenyl ring contributes to its potential reactivity and biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with biological systems. The cyclopropane moiety introduces strain into the structure, potentially affecting its stability and reactivity. Due to its specific functional groups, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the presence of halogens can enhance lipophilicity, which may affect the compound's pharmacokinetics. Overall, 1-(4-Chloro-3-fluorophenyl)cyclopropanamine is a compound with distinct chemical properties that may have implications in research and drug development.
Formula:C9H9ClFN
InChI:InChI=1S/C9H9ClFN/c10-7-2-1-6(5-8(7)11)9(12)3-4-9/h1-2,5H,3-4,12H2
InChI key:InChIKey=IXHCNCRLGZJHBK-UHFFFAOYSA-N
SMILES:NC1(CC1)C2=CC(F)=C(Cl)C=C2
Synonyms:- 1-(4-Chloro-3-fluorophenyl)cyclopropanamine
- Cyclopropanamine, 1-(4-chloro-3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.