CAS 1260790-93-9

5-Bromo-2-(2-methylphenyl)pyrimidine

Description:

5-Bromo-2-(2-methylphenyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom and a 2-methylphenyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The pyrimidine ring contributes to the compound's aromaticity and stability, while the 2-methylphenyl substituent enhances its lipophilicity and may influence its biological activity. This compound is typically used in medicinal chemistry and material science, often serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 5-Bromo-2-(2-methylphenyl)pyrimidine is a versatile compound with significant implications in various fields of chemistry.

Formula: C₁₁H₉BrN₂

InChI: InChI=1S/C11H9BrN2/c1-8-4-2-3-5-10(8)11-13-6-9(12)7-14-11/h2-7H,1H3

InChI key: InChIKey=WAJFLHHJCQFQBT-UHFFFAOYSA-N

SMILES: CC1=C(C=2N=CC(Br)=CN2)C=CC=C1

Synonyms:

• Pyrimidine, 5-bromo-2-(2-methylphenyl)-
• 5-Bromo-2-(2-methylphenyl)pyrimidine