CAS 1260794-15-7

4-(2-Amino-3-hydroxypropyl)benzonitrile

Description:

4-(2-Amino-3-hydroxypropyl)benzonitrile, identified by its CAS number 1260794-15-7, is an organic compound characterized by the presence of a benzonitrile moiety substituted with an amino and a hydroxypropyl group. This compound features a benzene ring attached to a nitrile group (–C≡N) and a side chain that includes both an amino group (–NH2) and a hydroxyl group (–OH), contributing to its potential as a versatile building block in organic synthesis. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents, potential for hydrogen bonding, and reactivity in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may have applications in pharmaceuticals or as an intermediate in the synthesis of other chemical entities due to its functional diversity. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1S/C10H12N2O/c11-6-9-3-1-8(2-4-9)5-10(12)7-13/h1-4,10,13H,5,7,12H2

InChI key: InChIKey=ZWTPUAUMNZUQCM-UHFFFAOYSA-N

SMILES: C(C(CO)N)C1=CC=C(C#N)C=C1

Synonyms:

• 4-(2-Amino-3-hydroxypropyl)benzonitrile
• 2-Amino-3-(4-cyanophenyl)propan-1-ol
• Benzonitrile, 4-(2-amino-3-hydroxypropyl)-