CAS 1260795-57-0
:3-(2-Chloroethyl)-4-methoxy-1H-indole
Description:
3-(2-Chloroethyl)-4-methoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methoxy group (-OCH3) at the 4-position and a chloroethyl group (-CH2CH2Cl) at the 3-position contributes to its unique chemical properties. This compound is likely to exhibit moderate lipophilicity due to the indole and methoxy functionalities, which can influence its solubility and reactivity. The chloroethyl group may participate in nucleophilic substitution reactions, making the compound potentially useful in medicinal chemistry and drug development. Additionally, the indole moiety is known for its biological activity, often serving as a scaffold in pharmaceuticals. The compound's molecular structure suggests it may interact with various biological targets, although specific biological activity would require empirical investigation. Safety and handling precautions should be observed due to the presence of the chloro group, which can pose health risks. Overall, 3-(2-Chloroethyl)-4-methoxy-1H-indole represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H12ClNO
InChI:InChI=1S/C11H12ClNO/c1-14-10-4-2-3-9-11(10)8(5-6-12)7-13-9/h2-4,7,13H,5-6H2,1H3
InChI key:InChIKey=ACLLCZPZFUHFGZ-UHFFFAOYSA-N
SMILES:C(CCl)C=1C=2C(NC1)=CC=CC2OC
Synonyms:- 1H-Indole, 3-(2-chloroethyl)-4-methoxy-
- 3-(2-Chloroethyl)-4-methoxy-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
