CAS 1260803-07-3

4-Chloro-2-(3-furanyl)pyrimidine

Description:

4-Chloro-2-(3-furanyl)pyrimidine is a heterocyclic organic compound characterized by the presence of a pyrimidine ring substituted with a chlorine atom and a furanyl group. The pyrimidine moiety consists of a six-membered ring containing two nitrogen atoms at positions 1 and 3, which contributes to its basicity and potential reactivity. The furanyl group, derived from furan, is a five-membered aromatic ring containing one oxygen atom, which can influence the compound's electronic properties and reactivity. This compound is typically of interest in medicinal chemistry and may exhibit biological activity due to its structural features. Its properties, such as solubility, melting point, and stability, can vary based on the specific conditions and solvents used. Additionally, the presence of the chlorine atom can enhance lipophilicity and affect the compound's interaction with biological targets. Overall, 4-Chloro-2-(3-furanyl)pyrimidine represents a versatile scaffold for further chemical modifications and potential applications in drug development.

Formula: C₈H₅ClN₂O

InChI: InChI=1S/C8H5ClN2O/c9-7-1-3-10-8(11-7)6-2-4-12-5-6/h1-5H

InChI key: InChIKey=GVOGQDGVRHJUCG-UHFFFAOYSA-N

SMILES: ClC1=NC(=NC=C1)C=2C=COC2

Synonyms:

• 4-Chloro-2-(3-furanyl)pyrimidine
• Pyrimidine, 4-chloro-2-(3-furanyl)-