CAS 1260807-51-9
:4-(1-Azetidinylmethyl)-3-fluorophenol
Description:
4-(1-Azetidinylmethyl)-3-fluorophenol is a chemical compound characterized by its unique structural features, which include a fluorophenol moiety and an azetidine ring. The presence of the fluorine atom at the meta position of the phenolic ring influences its electronic properties, potentially enhancing its reactivity and solubility in various solvents. The azetidine group, a four-membered nitrogen-containing ring, contributes to the compound's biological activity and may play a role in its interaction with biological targets. This compound is likely to exhibit moderate to high polarity due to the hydroxyl group (-OH) and the fluorine atom, which can engage in hydrogen bonding. Its potential applications may span medicinal chemistry, particularly in the development of pharmaceuticals, owing to the structural motifs that are often associated with bioactive compounds. As with many chemical substances, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be evaluated through empirical studies.
Formula:C10H12FNO
InChI:InChI=1S/C10H12FNO/c11-10-6-9(13)3-2-8(10)7-12-4-1-5-12/h2-3,6,13H,1,4-5,7H2
InChI key:InChIKey=YJCXTMUZMCEGEM-UHFFFAOYSA-N
SMILES:C(C1=C(F)C=C(O)C=C1)N2CCC2
Synonyms:- 4-(1-Azetidinylmethyl)-3-fluorophenol
- Phenol, 4-(1-azetidinylmethyl)-3-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
