CAS 1260809-92-4

5-Chloro-4-(1-methylethyl)-2-(trifluoromethyl)pyridine

Description:

5-Chloro-4-(1-methylethyl)-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 5-position and a trifluoromethyl group at the 2-position contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. The isopropyl group at the 4-position enhances its steric bulk, which can influence its interactions in biological systems and chemical reactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing trifluoromethyl group, which can affect nucleophilic attack and electrophilic substitution reactions. Additionally, the presence of halogens may impart specific biological activities, making it of interest in pharmaceutical research. Overall, this compound's structural features suggest potential applications in agrochemicals or medicinal chemistry, where modifications to the pyridine framework can lead to diverse functional properties.

Formula: C₉H₉ClF₃N

InChI: InChI=1S/C9H9ClF3N/c1-5(2)6-3-8(9(11,12)13)14-4-7(6)10/h3-5H,1-2H3

InChI key: InChIKey=ZJTJWGSHDTWRAQ-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C=C(C(F)(F)F)N=CC1Cl

Synonyms:

• Pyridine, 5-chloro-4-(1-methylethyl)-2-(trifluoromethyl)-
• 5-Chloro-4-(1-methylethyl)-2-(trifluoromethyl)pyridine

Pyridine, 5-chloro-4-(1-methylethyl)-2-(trifluoromethyl)-

CAS: 1260809-92-4

Formula: C₉H₉ClF₃N

Molecular weight: 223.6227

Ref: IN-DA000RCX