CAS 1260810-04-5

Ethyl 2-chloro-3-hydroxybenzoate

Description:

Ethyl 2-chloro-3-hydroxybenzoate, with the CAS number 1260810-04-5, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, where a chloro group and a hydroxy group are substituted on the aromatic ring. This compound is typically characterized by its moderate polarity due to the presence of both the hydroxyl and ester functional groups, which can influence its solubility in various solvents. Ethyl 2-chloro-3-hydroxybenzoate may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis often involves the reaction of 2-chloro-3-hydroxybenzoic acid with ethanol in the presence of a suitable catalyst. The compound's stability, reactivity, and potential applications can vary based on the specific conditions under which it is handled. As with many chemical substances, safety precautions should be observed when working with it, including the use of personal protective equipment and proper storage to prevent degradation or unwanted reactions.

Formula: C₉H₉ClO₃

InChI: InChI=1S/C9H9ClO3/c1-2-13-9(12)6-4-3-5-7(11)8(6)10/h3-5,11H,2H2,1H3

InChI key: InChIKey=BJRWARWQJAZJSJ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(Cl)C(O)=CC=C1

Synonyms:

• Ethyl 2-chloro-3-hydroxybenzoate
• Benzoic acid, 2-chloro-3-hydroxy-, ethyl ester