CymitQuimica logo

CAS 1260810-99-8

:

Description:
The chemical substance with the CAS number 1260810-99-8 is known as 2,4-Dichloro-5-(trifluoromethyl)pyrimidine. This compound is characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of two chlorine atoms and a trifluoromethyl group at specific positions on the ring contributes to its unique chemical properties, including its reactivity and potential applications in various fields. Typically, compounds like this are of interest in agricultural chemistry, particularly as herbicides or fungicides, due to their ability to interfere with biological processes in target organisms. Additionally, the trifluoromethyl group enhances the lipophilicity and metabolic stability of the compound, making it more effective in biological systems. Safety and handling precautions are essential when working with such chemicals, as they may pose environmental and health risks. Overall, 2,4-Dichloro-5-(trifluoromethyl)pyrimidine is a notable compound in the realm of synthetic organic chemistry and agrochemicals.
Formula:C18H20N2O4
InChI:InChI=1S/C18H20N2O4/c1-18(2,3)24-17(22)20-16(21)23-15-10-7-11-19-14(15)12-13-8-5-4-6-9-13/h4-11H,12H2,1-3H3,(H,20,21,22)
InChI key:InChIKey=WKOUJAJBDIMBGV-UHFFFAOYSA-N
SMILES:C(C1=C(OC(NC(OC(C)(C)C)=O)=O)C=CC=N1)C2=CC=CC=C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.