
CAS 1260812-61-0
:Pyridine, 2-(3-azetidinyl)-5-methoxy-
Description:
Pyridine, 2-(3-azetidinyl)-5-methoxy- is a heterocyclic organic compound characterized by a pyridine ring substituted with a methoxy group and an azetidine moiety. The presence of the pyridine ring imparts basicity to the compound, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The methoxy group enhances the compound's solubility in organic solvents and can influence its reactivity and electronic properties. The azetidine ring, a four-membered saturated nitrogen-containing ring, contributes to the compound's structural complexity and may affect its biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and interactions would depend on further studies, including its synthesis, stability, and potential therapeutic effects. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical and pharmaceutical contexts.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-12-8-2-3-9(11-6-8)7-4-10-5-7/h2-3,6-7,10H,4-5H2,1H3
InChI key:InChIKey=ARWFCSIWZXKQBW-UHFFFAOYSA-N
SMILES:O(C)C1=CC=C(N=C1)C2CNC2
Synonyms:- 2-(Azetidin-3-yl)-5-methoxypyridine
- 3-(5-Methoxy-2-pyridyl)azetidine
- Pyridine, 2-(3-azetidinyl)-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.