
CAS 1260812-79-0
:2,3,6-Trifluorobenzenecarboximidamide
Description:
2,3,6-Trifluorobenzenecarboximidamide is a chemical compound characterized by the presence of a benzene ring substituted with three fluorine atoms and an amidine functional group. The trifluoromethyl groups significantly influence its chemical reactivity and physical properties, often enhancing its polarity and potential for hydrogen bonding. This compound is typically a solid at room temperature and may exhibit high thermal stability due to the strong C-F bonds. Its unique structure makes it of interest in various fields, including medicinal chemistry and materials science, where fluorinated compounds are often sought for their unique biological and physical properties. The presence of the carboximidamide group suggests potential applications in the synthesis of pharmaceuticals or agrochemicals, as amidines can act as versatile intermediates in organic synthesis. Additionally, the trifluoromethyl substituents may impart specific electronic properties, making this compound a candidate for further research in drug development or as a building block in complex organic molecules.
Formula:C7H5F3N2
InChI:InChI=1S/C7H5F3N2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H3,11,12)
InChI key:InChIKey=YGAFQIUAGDQWEK-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C(F)C(F)=CC=C1F
Synonyms:- Benzenecarboximidamide, 2,3,6-trifluoro-
- 2,3,6-Trifluorobenzene-1-carboximidamide
- 2,3,6-Trifluorobenzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.